C15H10ClN3O7 — CID 4633777
methyl 4-[(4-chloro-3,5-dinitrobenzoyl)amino]benzoate (PubChem CID 4633777) has the molecular formula C15H10ClN3O7 and a molecular weight of 379.71 g/mol. Its IUPAC name is methyl 4-[(4-chloro-3,5-dinitrobenzoyl)amino]benzoate.
| Compound Name | methyl 4-[(4-chloro-3,5-dinitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 4633777 |
| Molecular Formula | C15H10ClN3O7 |
| Molecular Weight | 379.71 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | methyl 4-[(4-chloro-3,5-dinitrobenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H10ClN3O7/c1-26-15(21)8-2-4-10(5-3-8)17-14(20)9-6-11(18(22)23)13(16)12(7-9)19(24)25/h2-7H,1H3,(H,17,20) |
| InChIKey | OKROAKIGLOWDCP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|