C10H10ClN3O5 — CID 4628263
4-chloro-3,5-dinitro-N-propan-2-ylbenzamide (PubChem CID 4628263) has the molecular formula C10H10ClN3O5 and a molecular weight of 287.66 g/mol. Its IUPAC name is 4-chloro-3,5-dinitro-N-propan-2-ylbenzamide.
| Compound Name | 4-chloro-3,5-dinitro-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4628263 |
| Molecular Formula | C10H10ClN3O5 |
| Molecular Weight | 287.66 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 4-chloro-3,5-dinitro-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10ClN3O5/c1-5(2)12-10(15)6-3-7(13(16)17)9(11)8(4-6)14(18)19/h3-5H,1-2H3,(H,12,15) |
| InChIKey | GNQDQLWLKOESFJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|