C12H10Cl2N4O3 — CID 106211219
3,4-dichloro-5-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide (PubChem CID 106211219) has the molecular formula C12H10Cl2N4O3 and a molecular weight of 329.14 g/mol. Its IUPAC name is 3,4-dichloro-5-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide.
| Compound Name | 3,4-dichloro-5-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 106211219 |
| Molecular Formula | C12H10Cl2N4O3 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 3,4-dichloro-5-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1)c1cn[nH]c1 |
| InChI | InChI=1S/C12H10Cl2N4O3/c1-6(8-4-15-16-5-8)17-12(19)7-2-9(13)11(14)10(3-7)18(20)21/h2-6H,1H3,(H,15,16)(H,17,19) |
| InChIKey | RDAQMSOXPMDYOQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|