C12H10F2N4O3 — CID 103856245
2,5-difluoro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide (PubChem CID 103856245) has the molecular formula C12H10F2N4O3 and a molecular weight of 296.23 g/mol. Its IUPAC name is 2,5-difluoro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide.
| Compound Name | 2,5-difluoro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103856245 |
| Molecular Formula | C12H10F2N4O3 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2,5-difluoro-4-nitro-N-[1-(1H-pyrazol-4-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(F)c([N+](=O)[O-])cc1F)c1cn[nH]c1 |
| InChI | InChI=1S/C12H10F2N4O3/c1-6(7-4-15-16-5-7)17-12(19)8-2-10(14)11(18(20)21)3-9(8)13/h2-6H,1H3,(H,15,16)(H,17,19) |
| InChIKey | AOGNBNSNUAZXID-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|