C10H6F2N4O3 — CID 115750799
2,5-difluoro-4-nitro-N-(1H-pyrazol-4-yl)benzamide (PubChem CID 115750799) has the molecular formula C10H6F2N4O3 and a molecular weight of 268.18 g/mol. Its IUPAC name is 2,5-difluoro-4-nitro-N-(1H-pyrazol-4-yl)benzamide.
| Compound Name | 2,5-difluoro-4-nitro-N-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 115750799 |
| Molecular Formula | C10H6F2N4O3 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2,5-difluoro-4-nitro-N-(1H-pyrazol-4-yl)benzamide |
| SMILES | O=C(Nc1cn[nH]c1)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H6F2N4O3/c11-7-2-9(16(18)19)8(12)1-6(7)10(17)15-5-3-13-14-4-5/h1-4H,(H,13,14)(H,15,17) |
| InChIKey | TUQFARYEOYZBBL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|