C18H17N3O7 — CID 19174873
propan-2-yl 4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate (PubChem CID 19174873) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is propan-2-yl 4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate.
| Compound Name | propan-2-yl 4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 19174873 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | propan-2-yl 4-[(4-methyl-3,5-dinitrobenzoyl)amino]benzoate |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)Nc2ccc(C(=O)OC(C)C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17N3O7/c1-10(2)28-18(23)12-4-6-14(7-5-12)19-17(22)13-8-15(20(24)25)11(3)16(9-13)21(26)27/h4-10H,1-3H3,(H,19,22) |
| InChIKey | DBJSAESTMVUTHF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|