C17H15N3O7 — CID 7709474
[(2R)-1-anilino-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate (PubChem CID 7709474) has the molecular formula C17H15N3O7 and a molecular weight of 373.32 g/mol. Its IUPAC name is [(2R)-1-anilino-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate.
| Compound Name | [(2R)-1-anilino-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 7709474 |
| Molecular Formula | C17H15N3O7 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [(2R)-1-anilino-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)O[C@H](C)C(=O)Nc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O7/c1-10-14(19(23)24)8-12(9-15(10)20(25)26)17(22)27-11(2)16(21)18-13-6-4-3-5-7-13/h3-9,11H,1-2H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | RGOZKJZHGLXJFG-LLVKDONJSA-N |
| XLogP | 3.00 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|