C18H17N3O8 — CID 4570787
[1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate (PubChem CID 4570787) has the molecular formula C18H17N3O8 and a molecular weight of 403.35 g/mol. Its IUPAC name is [1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate.
| Compound Name | [1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 4570787 |
| Molecular Formula | C18H17N3O8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [1-(4-methoxyanilino)-1-oxopropan-2-yl] 4-methyl-3,5-dinitrobenzoate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)c2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H17N3O8/c1-10-15(20(24)25)8-12(9-16(10)21(26)27)18(23)29-11(2)17(22)19-13-4-6-14(28-3)7-5-13/h4-9,11H,1-3H3,(H,19,22) |
| InChIKey | PWQNVYVNZQEKJB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|