C22H26N2O7 — CID 16797060
[1-(3,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-tert-butyl-3-nitrobenzoate (PubChem CID 16797060) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is [1-(3,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-tert-butyl-3-nitrobenzoate.
| Compound Name | [1-(3,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-tert-butyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 16797060 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [1-(3,5-dimethoxyanilino)-1-oxopropan-2-yl] 4-tert-butyl-3-nitrobenzoate |
| SMILES | COc1cc(NC(=O)C(C)OC(=O)c2ccc(C(C)(C)C)c([N+](=O)[O-])c2)cc(OC)c1 |
| InChI | InChI=1S/C22H26N2O7/c1-13(20(25)23-15-10-16(29-5)12-17(11-15)30-6)31-21(26)14-7-8-18(22(2,3)4)19(9-14)24(27)28/h7-13H,1-6H3,(H,23,25) |
| InChIKey | KRQFPBVSCFGWPR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|