C15H12N2O7 — CID 19181372
(4-methoxyphenyl) 4-methyl-3,5-dinitrobenzoate (PubChem CID 19181372) has the molecular formula C15H12N2O7 and a molecular weight of 332.27 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-methyl-3,5-dinitrobenzoate.
| Compound Name | (4-methoxyphenyl) 4-methyl-3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 19181372 |
| Molecular Formula | C15H12N2O7 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (4-methoxyphenyl) 4-methyl-3,5-dinitrobenzoate |
| SMILES | COc1ccc(OC(=O)c2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H12N2O7/c1-9-13(16(19)20)7-10(8-14(9)17(21)22)15(18)24-12-5-3-11(23-2)4-6-12/h3-8H,1-2H3 |
| InChIKey | IFDVKVBTLHNHGY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|