C17H13NO7 — CID 2666968
3-O-(4-acetylphenyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 2666968) has the molecular formula C17H13NO7 and a molecular weight of 343.29 g/mol. Its IUPAC name is 3-O-(4-acetylphenyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-(4-acetylphenyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2666968 |
| Molecular Formula | C17H13NO7 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 3-O-(4-acetylphenyl) 1-O-methyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)Oc2ccc(C(C)=O)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13NO7/c1-10(19)11-3-5-15(6-4-11)25-17(21)13-7-12(16(20)24-2)8-14(9-13)18(22)23/h3-9H,1-2H3 |
| InChIKey | LASFJPSQUCTBNY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|