About CID 57465046
CID 57465046 (PubChem CID 57465046) has the molecular formula C16H12BN2O10
and a molecular weight of 403.09 g/mol.
Molecular Properties
| Compound Name | CID 57465046 |
| PubChem CID | 57465046 |
| Molecular Formula | C16H12BN2O10 |
| Molecular Weight | 403.09 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | — |
| SMILES | COC(=O)c1cc(O[B]Oc2cc(C(=O)OC)cc([N+](=O)[O-])c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12BN2O10/c1-26-15(20)9-3-11(18(22)23)7-13(5-9)28-17-29-14-6-10(16(21)27-2)4-12(8-14)19(24)25/h3-8H,1-2H3 |
| InChIKey | DUNOBSWAOHGHBG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 57465046 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57465046?
The IUPAC name of CID 57465046 (CID 57465046) is not available.
What is the SMILES notation for CID 57465046?
The canonical SMILES for CID 57465046 is COC(=O)c1cc(O[B]Oc2cc(C(=O)OC)cc([N+](=O)[O-])c2)cc([N+](=O)[O-])c1.
What is the InChIKey of CID 57465046?
The InChIKey is DUNOBSWAOHGHBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BN2O10/c1-26-15(20)9-3-11(18(22)23)7-13(5-9)28-17-29-14-6-10(16(21)27-2)4-12(8-14)19(24)25/h3-8H,1-2H3.
What are the key properties of CID 57465046?
CID 57465046 has a molecular weight of 403.09 g/mol, XLogP of 2.07, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57465046 is sourced from PubChem (CID 57465046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).