C12H13NO8 — CID 171865014
methyl 3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-5-nitrobenzoate (PubChem CID 171865014) has the molecular formula C12H13NO8 and a molecular weight of 299.24 g/mol. Its IUPAC name is methyl 3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-5-nitrobenzoate.
| Compound Name | methyl 3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 171865014 |
| Molecular Formula | C12H13NO8 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | methyl 3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)C(=O)OC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13NO8/c1-20-11(16)7-3-6(4-8(5-7)13(18)19)9(14)10(15)12(17)21-2/h3-5,9-10,14-15H,1-2H3 |
| InChIKey | ZJNBIQGBVBUJFB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|