C10H12N2O6 — CID 171864446
methyl 3-(3-amino-4-nitrophenyl)-2,3-dihydroxypropanoate (PubChem CID 171864446) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is methyl 3-(3-amino-4-nitrophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(3-amino-4-nitrophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864446 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | methyl 3-(3-amino-4-nitrophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc([N+](=O)[O-])c(N)c1 |
| InChI | InChI=1S/C10H12N2O6/c1-18-10(15)9(14)8(13)5-2-3-7(12(16)17)6(11)4-5/h2-4,8-9,13-14H,11H2,1H3 |
| InChIKey | MSJVEBCUICIYIJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|