C11H14N2O7 — CID 171864956
methyl 3-(2-amino-5-methoxy-3-nitrophenyl)-2,3-dihydroxypropanoate (PubChem CID 171864956) has the molecular formula C11H14N2O7 and a molecular weight of 286.24 g/mol. Its IUPAC name is methyl 3-(2-amino-5-methoxy-3-nitrophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(2-amino-5-methoxy-3-nitrophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864956 |
| Molecular Formula | C11H14N2O7 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl 3-(2-amino-5-methoxy-3-nitrophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(OC)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C11H14N2O7/c1-19-5-3-6(8(12)7(4-5)13(17)18)9(14)10(15)11(16)20-2/h3-4,9-10,14-15H,12H2,1-2H3 |
| InChIKey | WFVLETWJXWKOOB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|