C10H9F2NO6 — CID 171864746
methyl 3-(2,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropanoate (PubChem CID 171864746) has the molecular formula C10H9F2NO6 and a molecular weight of 277.18 g/mol. Its IUPAC name is methyl 3-(2,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(2,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864746 |
| Molecular Formula | C10H9F2NO6 |
| Molecular Weight | 277.18 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | methyl 3-(2,5-difluoro-4-nitrophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C10H9F2NO6/c1-19-10(16)9(15)8(14)4-2-6(12)7(13(17)18)3-5(4)11/h2-3,8-9,14-15H,1H3 |
| InChIKey | KQTRYBDFJKLNIG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|