C11H14FNO4 — CID 171864078
methyl 3-(4-amino-5-fluoro-2-methylphenyl)-2,3-dihydroxypropanoate (PubChem CID 171864078) has the molecular formula C11H14FNO4 and a molecular weight of 243.23 g/mol. Its IUPAC name is methyl 3-(4-amino-5-fluoro-2-methylphenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(4-amino-5-fluoro-2-methylphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864078 |
| Molecular Formula | C11H14FNO4 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methyl 3-(4-amino-5-fluoro-2-methylphenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(F)c(N)cc1C |
| InChI | InChI=1S/C11H14FNO4/c1-5-3-8(13)7(12)4-6(5)9(14)10(15)11(16)17-2/h3-4,9-10,14-15H,13H2,1-2H3 |
| InChIKey | KLTGSBKBUJXUBN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|