C12H16FNO4 — CID 171895606
methyl 4-(4-amino-5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171895606) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is methyl 4-(4-amino-5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(4-amino-5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895606 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | methyl 4-(4-amino-5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cc(F)c(N)cc1C |
| InChI | InChI=1S/C12H16FNO4/c1-6-3-9(14)8(13)4-7(6)12(17)10(15)5-11(16)18-2/h3-4,10,12,15,17H,5,14H2,1-2H3 |
| InChIKey | HZPZPRXYEDPHOX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|