C13H14F2O5 — CID 171896186
methyl 4-(5-acetyl-2,4-difluorophenyl)-3,4-dihydroxybutanoate (PubChem CID 171896186) has the molecular formula C13H14F2O5 and a molecular weight of 288.25 g/mol. Its IUPAC name is methyl 4-(5-acetyl-2,4-difluorophenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(5-acetyl-2,4-difluorophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896186 |
| Molecular Formula | C13H14F2O5 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | methyl 4-(5-acetyl-2,4-difluorophenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cc(C(C)=O)c(F)cc1F |
| InChI | InChI=1S/C13H14F2O5/c1-6(16)7-3-8(10(15)4-9(7)14)13(19)11(17)5-12(18)20-2/h3-4,11,13,17,19H,5H2,1-2H3 |
| InChIKey | WFSNZVZPOCNNKZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |