C11H11BrF2O4 — CID 171896702
methyl 4-(4-bromo-2,5-difluorophenyl)-3,4-dihydroxybutanoate (PubChem CID 171896702) has the molecular formula C11H11BrF2O4 and a molecular weight of 325.11 g/mol. Its IUPAC name is methyl 4-(4-bromo-2,5-difluorophenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(4-bromo-2,5-difluorophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896702 |
| Molecular Formula | C11H11BrF2O4 |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | methyl 4-(4-bromo-2,5-difluorophenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C11H11BrF2O4/c1-18-10(16)4-9(15)11(17)5-2-8(14)6(12)3-7(5)13/h2-3,9,11,15,17H,4H2,1H3 |
| InChIKey | GPEOTJOABUJWLN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|