C11H11Br2FO4 — CID 171896706
methyl 4-(2,4-dibromo-6-fluorophenyl)-3,4-dihydroxybutanoate (PubChem CID 171896706) has the molecular formula C11H11Br2FO4 and a molecular weight of 386.01 g/mol. Its IUPAC name is methyl 4-(2,4-dibromo-6-fluorophenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(2,4-dibromo-6-fluorophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896706 |
| Molecular Formula | C11H11Br2FO4 |
| Molecular Weight | 386.01 g/mol |
| Exact Mass | 383.90 |
| IUPAC Name | methyl 4-(2,4-dibromo-6-fluorophenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1c(F)cc(Br)cc1Br |
| InChI | InChI=1S/C11H11Br2FO4/c1-18-9(16)4-8(15)11(17)10-6(13)2-5(12)3-7(10)14/h2-3,8,11,15,17H,4H2,1H3 |
| InChIKey | YHAOOFOFKMQSLL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.01 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |