C10H9BrF2O4 — CID 171878788
4-(4-bromo-2,6-difluorophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878788) has the molecular formula C10H9BrF2O4 and a molecular weight of 311.08 g/mol. Its IUPAC name is 4-(4-bromo-2,6-difluorophenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(4-bromo-2,6-difluorophenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878788 |
| Molecular Formula | C10H9BrF2O4 |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 4-(4-bromo-2,6-difluorophenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H9BrF2O4/c11-4-1-5(12)9(6(13)2-4)10(17)7(14)3-8(15)16/h1-2,7,10,14,17H,3H2,(H,15,16) |
| InChIKey | UGKLBSJDPWRFLX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |