C11H10F2O5 — CID 171878026
4-(2,5-difluoro-4-formylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878026) has the molecular formula C11H10F2O5 and a molecular weight of 260.19 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-formylphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(2,5-difluoro-4-formylphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878026 |
| Molecular Formula | C11H10F2O5 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-(2,5-difluoro-4-formylphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=Cc1cc(F)c(C(O)C(O)CC(=O)O)cc1F |
| InChI | InChI=1S/C11H10F2O5/c12-7-2-6(8(13)1-5(7)4-14)11(18)9(15)3-10(16)17/h1-2,4,9,11,15,18H,3H2,(H,16,17) |
| InChIKey | HFXSVIVQGWOSOS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|