4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid

C12H14O5 — CID 171877603

IUPAC4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid
SMILESCc1ccc(C(O)C(O)CC(=O)O)c(C=O)c1
InChIInChI=1S/C12H14O5/c1-7-2-3-9(8(4-7)6-13)12(17)10(14)5-11(15)16/h2-4,6,10,12,14,17H,5H2,1H3,(H,15,16)
InChIKeyGSDGVYIFANWQAH-UHFFFAOYSA-N
MW238.24 g/mol
LogP0.68
Rot. Bonds5

About 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid

4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877603) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid.

Molecular Properties

Compound Name4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid
PubChem CID171877603
Molecular FormulaC12H14O5
Molecular Weight238.24 g/mol
Exact Mass238.08
IUPAC Name4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid
SMILESCc1ccc(C(O)C(O)CC(=O)O)c(C=O)c1
InChIInChI=1S/C12H14O5/c1-7-2-3-9(8(4-7)6-13)12(17)10(14)5-11(15)16/h2-4,6,10,12,14,17H,5H2,1H3,(H,15,16)
InChIKeyGSDGVYIFANWQAH-UHFFFAOYSA-N
XLogP0.68
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 50.68
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid?
The IUPAC name of 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid (CID 171877603) is 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid.
What is the SMILES notation for 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid?
The canonical SMILES for 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid is Cc1ccc(C(O)C(O)CC(=O)O)c(C=O)c1.
What is the InChIKey of 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid?
The InChIKey is GSDGVYIFANWQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-7-2-3-9(8(4-7)6-13)12(17)10(14)5-11(15)16/h2-4,6,10,12,14,17H,5H2,1H3,(H,15,16).
What are the key properties of 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid?
4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid has a molecular weight of 238.24 g/mol, XLogP of 0.68, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-formyl-4-methylphenyl)-3,4-dihydroxybutanoic acid is sourced from PubChem (CID 171877603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).