C11H14O5 — CID 171877297
3,4-dihydroxy-4-(4-hydroxy-2-methylphenyl)butanoic acid (PubChem CID 171877297) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(4-hydroxy-2-methylphenyl)butanoic acid.
| Compound Name | 3,4-dihydroxy-4-(4-hydroxy-2-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 171877297 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3,4-dihydroxy-4-(4-hydroxy-2-methylphenyl)butanoic acid |
| SMILES | Cc1cc(O)ccc1C(O)C(O)CC(=O)O |
| InChI | InChI=1S/C11H14O5/c1-6-4-7(12)2-3-8(6)11(16)9(13)5-10(14)15/h2-4,9,11-13,16H,5H2,1H3,(H,14,15) |
| InChIKey | WQSPRCGBGPCBTA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |