4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid

C12H14O4 — CID 171877228

IUPAC4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid
SMILESC=Cc1ccccc1C(O)C(O)CC(=O)O
InChIInChI=1S/C12H14O4/c1-2-8-5-3-4-6-9(8)12(16)10(13)7-11(14)15/h2-6,10,12-13,16H,1,7H2,(H,14,15)
InChIKeyCROLYSSRCAECJR-UHFFFAOYSA-N
MW222.24 g/mol
LogP1.20
Rot. Bonds5

About 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid

4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877228) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid.

Molecular Properties

Compound Name4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid
PubChem CID171877228
Molecular FormulaC12H14O4
Molecular Weight222.24 g/mol
Exact Mass222.09
IUPAC Name4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid
SMILESC=Cc1ccccc1C(O)C(O)CC(=O)O
InChIInChI=1S/C12H14O4/c1-2-8-5-3-4-6-9(8)12(16)10(13)7-11(14)15/h2-6,10,12-13,16H,1,7H2,(H,14,15)
InChIKeyCROLYSSRCAECJR-UHFFFAOYSA-N
XLogP1.20
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.24
LogP ≤ 51.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid?
The IUPAC name of 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid (CID 171877228) is 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid.
What is the SMILES notation for 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid?
The canonical SMILES for 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid is C=Cc1ccccc1C(O)C(O)CC(=O)O.
What is the InChIKey of 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid?
The InChIKey is CROLYSSRCAECJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-2-8-5-3-4-6-9(8)12(16)10(13)7-11(14)15/h2-6,10,12-13,16H,1,7H2,(H,14,15).
What are the key properties of 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid?
4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid has a molecular weight of 222.24 g/mol, XLogP of 1.20, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethenylphenyl)-3,4-dihydroxybutanoic acid is sourced from PubChem (CID 171877228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).