C11H14O3 — CID 170817426
1-(2-ethenylphenyl)propane-1,2,3-triol (PubChem CID 170817426) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(2-ethenylphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-ethenylphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817426 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-(2-ethenylphenyl)propane-1,2,3-triol |
| SMILES | C=Cc1ccccc1C(O)C(O)CO |
| InChI | InChI=1S/C11H14O3/c1-2-8-5-3-4-6-9(8)11(14)10(13)7-12/h2-6,10-14H,1,7H2 |
| InChIKey | KXIHQTOSDBYYFV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |