C16H18O4 — CID 170819028
1-(2-phenylmethoxyphenyl)propane-1,2,3-triol (PubChem CID 170819028) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(2-phenylmethoxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-phenylmethoxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819028 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-(2-phenylmethoxyphenyl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H18O4/c17-10-14(18)16(19)13-8-4-5-9-15(13)20-11-12-6-2-1-3-7-12/h1-9,14,16-19H,10-11H2 |
| InChIKey | KSSZHWNJGLGEGK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |