C16H18O5 — CID 170819017
1-(2-hydroxy-4-phenylmethoxyphenyl)propane-1,2,3-triol (PubChem CID 170819017) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is 1-(2-hydroxy-4-phenylmethoxyphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2-hydroxy-4-phenylmethoxyphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819017 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(2-hydroxy-4-phenylmethoxyphenyl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C16H18O5/c17-9-15(19)16(20)13-7-6-12(8-14(13)18)21-10-11-4-2-1-3-5-11/h1-8,15-20H,9-10H2 |
| InChIKey | GKUDAKZLYJGVPZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |