C16H15NO4 — CID 171871416
2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanenitrile (PubChem CID 171871416) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanenitrile.
| Compound Name | 2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 171871416 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanenitrile |
| SMILES | N#CC(O)C(O)c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C16H15NO4/c17-9-15(19)16(20)13-7-6-12(8-14(13)18)21-10-11-4-2-1-3-5-11/h1-8,15-16,18-20H,10H2 |
| InChIKey | CZHCHRAGYNSNSG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|