C16H16O6 — CID 170825141
2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanoic acid (PubChem CID 170825141) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | 2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 170825141 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2,3-dihydroxy-3-(2-hydroxy-4-phenylmethoxyphenyl)propanoic acid |
| SMILES | O=C(O)C(O)C(O)c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C16H16O6/c17-13-8-11(22-9-10-4-2-1-3-5-10)6-7-12(13)14(18)15(19)16(20)21/h1-8,14-15,17-19H,9H2,(H,20,21) |
| InChIKey | QOOCHEKAZZSCJB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |