C16H20ClNO3 — CID 171214501
2-[(1R)-1-amino-3-hydroxypropyl]-5-phenylmethoxyphenol;hydrochloride (PubChem CID 171214501) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-hydroxypropyl]-5-phenylmethoxyphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-hydroxypropyl]-5-phenylmethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171214501 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[(1R)-1-amino-3-hydroxypropyl]-5-phenylmethoxyphenol;hydrochloride |
| SMILES | Cl.N[C@H](CCO)c1ccc(OCc2ccccc2)cc1O |
| InChI | InChI=1S/C16H19NO3.ClH/c17-15(8-9-18)14-7-6-13(10-16(14)19)20-11-12-4-2-1-3-5-12;/h1-7,10,15,18-19H,8-9,11,17H2;1H/t15-;/m1./s1 |
| InChIKey | HAKRUSKJJLEAPQ-XFULWGLBSA-N |
| XLogP | 2.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|