C20H26ClNO2 — CID 171214482
2-[(R)-amino(cyclohexyl)methyl]-5-phenylmethoxyphenol;hydrochloride (PubChem CID 171214482) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 2-[(R)-amino(cyclohexyl)methyl]-5-phenylmethoxyphenol;hydrochloride.
| Compound Name | 2-[(R)-amino(cyclohexyl)methyl]-5-phenylmethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171214482 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-[(R)-amino(cyclohexyl)methyl]-5-phenylmethoxyphenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1ccc(OCc2ccccc2)cc1O)C1CCCCC1 |
| InChI | InChI=1S/C20H25NO2.ClH/c21-20(16-9-5-2-6-10-16)18-12-11-17(13-19(18)22)23-14-15-7-3-1-4-8-15;/h1,3-4,7-8,11-13,16,20,22H,2,5-6,9-10,14,21H2;1H/t20-;/m1./s1 |
| InChIKey | FKXRUUVQCYQBKG-VEIFNGETSA-N |
| XLogP | 4.97 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|