C23H32Cl2N2O2 — CID 171283049
2-[(S)-cyclopentyl(piperazin-1-yl)methyl]-5-phenylmethoxyphenol;dihydrochloride (PubChem CID 171283049) has the molecular formula C23H32Cl2N2O2 and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-[(S)-cyclopentyl(piperazin-1-yl)methyl]-5-phenylmethoxyphenol;dihydrochloride.
| Compound Name | 2-[(S)-cyclopentyl(piperazin-1-yl)methyl]-5-phenylmethoxyphenol;dihydrochloride |
|---|---|
| PubChem CID | 171283049 |
| Molecular Formula | C23H32Cl2N2O2 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[(S)-cyclopentyl(piperazin-1-yl)methyl]-5-phenylmethoxyphenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1cc(OCc2ccccc2)ccc1[C@H](C1CCCC1)N1CCNCC1 |
| InChI | InChI=1S/C23H30N2O2.2ClH/c26-22-16-20(27-17-18-6-2-1-3-7-18)10-11-21(22)23(19-8-4-5-9-19)25-14-12-24-13-15-25;;/h1-3,6-7,10-11,16,19,23-24,26H,4-5,8-9,12-15,17H2;2*1H/t23-;;/m0../s1 |
| InChIKey | JHBHCPOWCJUMBB-IFUPQEAVSA-N |
| XLogP | 4.95 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|