C25H36Cl2N2O2 — CID 171280609
1-[(S)-cyclopentyl-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171280609) has the molecular formula C25H36Cl2N2O2 and a molecular weight of 467.48 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclopentyl-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171280609 |
| Molecular Formula | C25H36Cl2N2O2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 1-[(S)-cyclopentyl-(3-ethoxy-4-phenylmethoxyphenyl)methyl]piperazine;dihydrochloride |
| SMILES | CCOc1cc([C@H](C2CCCC2)N2CCNCC2)ccc1OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C25H34N2O2.2ClH/c1-2-28-24-18-22(12-13-23(24)29-19-20-8-4-3-5-9-20)25(21-10-6-7-11-21)27-16-14-26-15-17-27;;/h3-5,8-9,12-13,18,21,25-26H,2,6-7,10-11,14-17,19H2,1H3;2*1H/t25-;;/m0../s1 |
| InChIKey | YRCAWVCBKAQFTB-WLOLSGMKSA-N |
| XLogP | 5.64 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |