C18H30Cl2N2O2 — CID 171280900
1-[(S)-cyclobutyl-(3-ethoxy-4-methoxyphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171280900) has the molecular formula C18H30Cl2N2O2 and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(3-ethoxy-4-methoxyphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclobutyl-(3-ethoxy-4-methoxyphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171280900 |
| Molecular Formula | C18H30Cl2N2O2 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-[(S)-cyclobutyl-(3-ethoxy-4-methoxyphenyl)methyl]piperazine;dihydrochloride |
| SMILES | CCOc1cc([C@H](C2CCC2)N2CCNCC2)ccc1OC.Cl.Cl |
| InChI | InChI=1S/C18H28N2O2.2ClH/c1-3-22-17-13-15(7-8-16(17)21-2)18(14-5-4-6-14)20-11-9-19-10-12-20;;/h7-8,13-14,18-19H,3-6,9-12H2,1-2H3;2*1H/t18-;;/m0../s1 |
| InChIKey | ROKPUWXKZVJHRK-NTEVMMBTSA-N |
| XLogP | 3.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |