C23H32N2O4 — CID 3826604
1-[(3,4-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methyl]-1,4-diazepane (PubChem CID 3826604) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(3,4-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3826604 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)-(3-ethoxy-4-methoxyphenyl)methyl]-1,4-diazepane |
| SMILES | CCOc1cc(C(c2ccc(OC)c(OC)c2)N2CCCNCC2)ccc1OC |
| InChI | InChI=1S/C23H32N2O4/c1-5-29-22-16-18(8-10-20(22)27-3)23(25-13-6-11-24-12-14-25)17-7-9-19(26-2)21(15-17)28-4/h7-10,15-16,23-24H,5-6,11-14H2,1-4H3 |
| InChIKey | GZJSHOUBCUVZCG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |