C19H32N2O2 — CID 3285664
1-[1-(3-ethoxy-4-methoxyphenyl)pentyl]-1,4-diazepane (PubChem CID 3285664) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[1-(3-ethoxy-4-methoxyphenyl)pentyl]-1,4-diazepane.
| Compound Name | 1-[1-(3-ethoxy-4-methoxyphenyl)pentyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3285664 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 1-[1-(3-ethoxy-4-methoxyphenyl)pentyl]-1,4-diazepane |
| SMILES | CCCCC(c1ccc(OC)c(OCC)c1)N1CCCNCC1 |
| InChI | InChI=1S/C19H32N2O2/c1-4-6-8-17(21-13-7-11-20-12-14-21)16-9-10-18(22-3)19(15-16)23-5-2/h9-10,15,17,20H,4-8,11-14H2,1-3H3 |
| InChIKey | HFXWQZRRIYXFNH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |