C23H32N2O2 — CID 171308355
1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)pentyl]piperazine (PubChem CID 171308355) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)pentyl]piperazine.
| Compound Name | 1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)pentyl]piperazine |
|---|---|
| PubChem CID | 171308355 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)pentyl]piperazine |
| SMILES | CCCC[C@H](c1ccc(OCc2ccccc2)c(OC)c1)N1CCNCC1 |
| InChI | InChI=1S/C23H32N2O2/c1-3-4-10-21(25-15-13-24-14-16-25)20-11-12-22(23(17-20)26-2)27-18-19-8-6-5-7-9-19/h5-9,11-12,17,21,24H,3-4,10,13-16,18H2,1-2H3/t21-/m1/s1 |
| InChIKey | DBJPAQNSFALAQP-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |