C20H28Cl2N2O2 — CID 171295691
1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171295691) has the molecular formula C20H28Cl2N2O2 and a molecular weight of 399.36 g/mol. Its IUPAC name is 1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295691 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-[(1R)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine;dihydrochloride |
| SMILES | COc1cc([C@@H](C)N2CCNCC2)ccc1OCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C20H26N2O2.2ClH/c1-16(22-12-10-21-11-13-22)18-8-9-19(20(14-18)23-2)24-15-17-6-4-3-5-7-17;;/h3-9,14,16,21H,10-13,15H2,1-2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | RAYRKPHGHJBHJN-GGMCWBHBSA-N |
| XLogP | 4.08 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |