C20H23F3N2O2 — CID 171181228
1-[(1R)-2,2,2-trifluoro-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine (PubChem CID 171181228) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 171181228 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]piperazine |
| SMILES | COc1cc([C@@H](N2CCNCC2)C(F)(F)F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-26-18-13-16(19(20(21,22)23)25-11-9-24-10-12-25)7-8-17(18)27-14-15-5-3-2-4-6-15/h2-8,13,19,24H,9-12,14H2,1H3/t19-/m1/s1 |
| InChIKey | PAJKCPBNNOTBDR-LJQANCHMSA-N |
| XLogP | 3.78 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |