C23H32N2O2 — CID 171304822
1-[(1R)-1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylbutyl]piperazine (PubChem CID 171304822) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylbutyl]piperazine.
| Compound Name | 1-[(1R)-1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171304822 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 1-[(1R)-1-(4-methoxy-3-phenylmethoxyphenyl)-2-methylbutyl]piperazine |
| SMILES | CCC(C)[C@H](c1ccc(OC)c(OCc2ccccc2)c1)N1CCNCC1 |
| InChI | InChI=1S/C23H32N2O2/c1-4-18(2)23(25-14-12-24-13-15-25)20-10-11-21(26-3)22(16-20)27-17-19-8-6-5-7-9-19/h5-11,16,18,23-24H,4,12-15,17H2,1-3H3/t18?,23-/m1/s1 |
| InChIKey | BCYSBKFXHNUVCE-WBPHRXDCSA-N |
| XLogP | 4.27 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |