C18H32Cl2N2O2 — CID 171304751
1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride (PubChem CID 171304751) has the molecular formula C18H32Cl2N2O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171304751 |
| Molecular Formula | C18H32Cl2N2O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCOc1cc([C@@H](C(C)CC)N2CCNCC2)ccc1OC.Cl.Cl |
| InChI | InChI=1S/C18H30N2O2.2ClH/c1-5-14(3)18(20-11-9-19-10-12-20)15-7-8-16(21-4)17(13-15)22-6-2;;/h7-8,13-14,18-19H,5-6,9-12H2,1-4H3;2*1H/t14?,18-;;/m1../s1 |
| InChIKey | PWPLEQOEDLKLAB-HVZXYGIMSA-N |
| XLogP | 3.93 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |