C24H34N2O3 — CID 171305634
1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2-methylbutyl]piperazine (PubChem CID 171305634) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2-methylbutyl]piperazine.
| Compound Name | 1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2-methylbutyl]piperazine |
|---|---|
| PubChem CID | 171305634 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1-[(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2-methylbutyl]piperazine |
| SMILES | CCC(C)[C@@H](c1cc(OC)c(OC)cc1OCc1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C24H34N2O3/c1-5-18(2)24(26-13-11-25-12-14-26)20-15-22(27-3)23(28-4)16-21(20)29-17-19-9-7-6-8-10-19/h6-10,15-16,18,24-25H,5,11-14,17H2,1-4H3/t18?,24-/m0/s1 |
| InChIKey | ILUDHMGQMRJZOW-LUTIACGYSA-N |
| XLogP | 4.28 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |