C23H29F3N2O3 — CID 171172753
1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171172753) has the molecular formula C23H29F3N2O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171172753 |
| Molecular Formula | C23H29F3N2O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | COc1cc(OCc2ccccc2)c([C@@H](CCC(F)(F)F)N2CCNCC2)cc1OC |
| InChI | InChI=1S/C23H29F3N2O3/c1-29-21-14-18(19(8-9-23(24,25)26)28-12-10-27-11-13-28)20(15-22(21)30-2)31-16-17-6-4-3-5-7-17/h3-7,14-15,19,27H,8-13,16H2,1-2H3/t19-/m1/s1 |
| InChIKey | VMQDBOZETLVYBJ-LJQANCHMSA-N |
| XLogP | 4.57 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |