C23H29F3N2O2 — CID 171172152
1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171172152) has the molecular formula C23H29F3N2O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171172152 |
| Molecular Formula | C23H29F3N2O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 1-[(1R)-1-(3-ethoxy-4-phenylmethoxyphenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | CCOc1cc([C@@H](CCC(F)(F)F)N2CCNCC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H29F3N2O2/c1-2-29-22-16-19(8-9-21(22)30-17-18-6-4-3-5-7-18)20(10-11-23(24,25)26)28-14-12-27-13-15-28/h3-9,16,20,27H,2,10-15,17H2,1H3/t20-/m1/s1 |
| InChIKey | MTNQTFAVXCQQGF-HXUWFJFHSA-N |
| XLogP | 4.95 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |