C16H23F3N2O2 — CID 171168746
2-ethoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (PubChem CID 171168746) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-ethoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 2-ethoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171168746 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-ethoxy-4-[(1R)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| SMILES | CCOc1cc([C@@H](CCC(F)(F)F)N2CCNCC2)ccc1O |
| InChI | InChI=1S/C16H23F3N2O2/c1-2-23-15-11-12(3-4-14(15)22)13(5-6-16(17,18)19)21-9-7-20-8-10-21/h3-4,11,13,20,22H,2,5-10H2,1H3/t13-/m1/s1 |
| InChIKey | AFRVSTKAGOHUFH-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |