C15H21F3N2O — CID 171167189
2-methyl-4-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol (PubChem CID 171167189) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-methyl-4-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol.
| Compound Name | 2-methyl-4-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
|---|---|
| PubChem CID | 171167189 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-methyl-4-[(1S)-4,4,4-trifluoro-1-piperazin-1-ylbutyl]phenol |
| SMILES | Cc1cc([C@H](CCC(F)(F)F)N2CCNCC2)ccc1O |
| InChI | InChI=1S/C15H21F3N2O/c1-11-10-12(2-3-14(11)21)13(4-5-15(16,17)18)20-8-6-19-7-9-20/h2-3,10,13,19,21H,4-9H2,1H3/t13-/m0/s1 |
| InChIKey | OTBVQCGMZIIEDU-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |