C16H23F3N2 — CID 171169052
1-[(1R)-1-(3,5-dimethylphenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171169052) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 1-[(1R)-1-(3,5-dimethylphenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1R)-1-(3,5-dimethylphenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171169052 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[(1R)-1-(3,5-dimethylphenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | Cc1cc(C)cc([C@@H](CCC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H23F3N2/c1-12-9-13(2)11-14(10-12)15(3-4-16(17,18)19)21-7-5-20-6-8-21/h9-11,15,20H,3-8H2,1-2H3/t15-/m1/s1 |
| InChIKey | PWMYVXLPTMHRCJ-OAHLLOKOSA-N |
| XLogP | 3.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |