C14H17F5N2 — CID 171164426
1-[(1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutyl]piperazine (PubChem CID 171164426) has the molecular formula C14H17F5N2 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-[(1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutyl]piperazine.
| Compound Name | 1-[(1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutyl]piperazine |
|---|---|
| PubChem CID | 171164426 |
| Molecular Formula | C14H17F5N2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[(1S)-1-(3,5-difluorophenyl)-4,4,4-trifluorobutyl]piperazine |
| SMILES | Fc1cc(F)cc([C@H](CCC(F)(F)F)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H17F5N2/c15-11-7-10(8-12(16)9-11)13(1-2-14(17,18)19)21-5-3-20-4-6-21/h7-9,13,20H,1-6H2/t13-/m0/s1 |
| InChIKey | BWNLXGGYNHQAEI-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |